About ethane;N-(2-phenylethyl)aniline
ethane;N-(2-phenylethyl)aniline (PubChem CID 91194556) has the molecular formula C18H27N
and a molecular weight of 257.42 g/mol. Its IUPAC name is ethane;N-(2-phenylethyl)aniline.
Molecular Properties
| Compound Name | ethane;N-(2-phenylethyl)aniline |
| PubChem CID | 91194556 |
| Molecular Formula | C18H27N |
| Molecular Weight | 257.42 g/mol |
| Exact Mass | 257.21 |
| IUPAC Name | ethane;N-(2-phenylethyl)aniline |
| SMILES | CC.CC.c1ccc(CCNc2ccccc2)cc1 |
| InChI | InChI=1S/C14H15N.2C2H6/c1-3-7-13(8-4-1)11-12-15-14-9-5-2-6-10-14;2*1-2/h1-10,15H,11-12H2;2*1-2H3 |
| InChIKey | NLUUTOFGRMNWFD-UHFFFAOYSA-N |
| XLogP | 5.39 |
| TPSA | 12.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 257.42 |
| LogP ≤ 5 | 5.39 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
Analyze ethane;N-(2-phenylethyl)aniline with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of ethane;N-(2-phenylethyl)aniline?
The IUPAC name of ethane;N-(2-phenylethyl)aniline (CID 91194556) is ethane;N-(2-phenylethyl)aniline.
What is the SMILES notation for ethane;N-(2-phenylethyl)aniline?
The canonical SMILES for ethane;N-(2-phenylethyl)aniline is CC.CC.c1ccc(CCNc2ccccc2)cc1.
What is the InChIKey of ethane;N-(2-phenylethyl)aniline?
The InChIKey is NLUUTOFGRMNWFD-UHFFFAOYSA-N. The full InChI is InChI=1S/C14H15N.2C2H6/c1-3-7-13(8-4-1)11-12-15-14-9-5-2-6-10-14;2*1-2/h1-10,15H,11-12H2;2*1-2H3.
What are the key properties of ethane;N-(2-phenylethyl)aniline?
ethane;N-(2-phenylethyl)aniline has a molecular weight of 257.42 g/mol, XLogP of 5.39, 4 rotatable bonds, 1 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for ethane;N-(2-phenylethyl)aniline is sourced from PubChem (CID 91194556), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).