C14H18ClN5O — CID 146094090
2-benzyl-3-[(2,5-diamino-6-chloropyrimidin-4-yl)amino]propan-1-ol (PubChem CID 146094090) has the molecular formula C14H18ClN5O and a molecular weight of 307.79 g/mol. Its IUPAC name is 2-benzyl-3-[(2,5-diamino-6-chloropyrimidin-4-yl)amino]propan-1-ol.
| Compound Name | 2-benzyl-3-[(2,5-diamino-6-chloropyrimidin-4-yl)amino]propan-1-ol |
|---|---|
| PubChem CID | 146094090 |
| Molecular Formula | C14H18ClN5O |
| Molecular Weight | 307.79 g/mol |
| Exact Mass | 307.12 |
| IUPAC Name | 2-benzyl-3-[(2,5-diamino-6-chloropyrimidin-4-yl)amino]propan-1-ol |
| SMILES | Nc1nc(Cl)c(N)c(NCC(CO)Cc2ccccc2)n1 |
| InChI | InChI=1S/C14H18ClN5O/c15-12-11(16)13(20-14(17)19-12)18-7-10(8-21)6-9-4-2-1-3-5-9/h1-5,10,21H,6-8,16H2,(H3,17,18,19,20) |
| InChIKey | RQUIUNDCYDPMJF-UHFFFAOYSA-N |
| XLogP | 1.56 |
| TPSA | 110.08 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 307.79 |
| LogP ≤ 5 | 1.56 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 6 |