C14H16N6O — CID 115669387
2-[(2-amino-7H-purin-6-yl)amino]-3-phenylpropan-1-ol (PubChem CID 115669387) has the molecular formula C14H16N6O and a molecular weight of 284.32 g/mol. Its IUPAC name is 2-[(2-amino-7H-purin-6-yl)amino]-3-phenylpropan-1-ol.
| Compound Name | 2-[(2-amino-7H-purin-6-yl)amino]-3-phenylpropan-1-ol |
|---|---|
| PubChem CID | 115669387 |
| Molecular Formula | C14H16N6O |
| Molecular Weight | 284.32 g/mol |
| Exact Mass | 284.14 |
| IUPAC Name | 2-[(2-amino-7H-purin-6-yl)amino]-3-phenylpropan-1-ol |
| SMILES | Nc1nc(NC(CO)Cc2ccccc2)c2[nH]cnc2n1 |
| InChI | InChI=1S/C14H16N6O/c15-14-19-12-11(16-8-17-12)13(20-14)18-10(7-21)6-9-4-2-1-3-5-9/h1-5,8,10,21H,6-7H2,(H4,15,16,17,18,19,20) |
| InChIKey | KQIHYHIWELIWAL-UHFFFAOYSA-N |
| XLogP | 0.95 |
| TPSA | 112.74 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 284.32 |
| LogP ≤ 5 | 0.95 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 6 |