C14H14ClN5O — CID 56622135
(2S)-2-[(2-chloro-7H-purin-6-yl)amino]-3-phenylpropan-1-ol (PubChem CID 56622135) has the molecular formula C14H14ClN5O and a molecular weight of 303.75 g/mol. Its IUPAC name is (2S)-2-[(2-chloro-7H-purin-6-yl)amino]-3-phenylpropan-1-ol.
| Compound Name | (2S)-2-[(2-chloro-7H-purin-6-yl)amino]-3-phenylpropan-1-ol |
|---|---|
| PubChem CID | 56622135 |
| Molecular Formula | C14H14ClN5O |
| Molecular Weight | 303.75 g/mol |
| Exact Mass | 303.09 |
| IUPAC Name | (2S)-2-[(2-chloro-7H-purin-6-yl)amino]-3-phenylpropan-1-ol |
| SMILES | OC[C@H](Cc1ccccc1)Nc1nc(Cl)nc2nc[nH]c12 |
| InChI | InChI=1S/C14H14ClN5O/c15-14-19-12-11(16-8-17-12)13(20-14)18-10(7-21)6-9-4-2-1-3-5-9/h1-5,8,10,21H,6-7H2,(H2,16,17,18,19,20)/t10-/m0/s1 |
| InChIKey | FXLWMSDGCBLBNF-JTQLQIEISA-N |
| XLogP | 2.02 |
| TPSA | 86.72 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 303.75 |
| LogP ≤ 5 | 2.02 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |