C17H19ClN6 — CID 87659973
N-(4-benzylpiperidin-1-yl)-2-chloro-7H-purin-6-amine (PubChem CID 87659973) has the molecular formula C17H19ClN6 and a molecular weight of 342.83 g/mol. Its IUPAC name is N-(4-benzylpiperidin-1-yl)-2-chloro-7H-purin-6-amine.
| Compound Name | N-(4-benzylpiperidin-1-yl)-2-chloro-7H-purin-6-amine |
|---|---|
| PubChem CID | 87659973 |
| Molecular Formula | C17H19ClN6 |
| Molecular Weight | 342.83 g/mol |
| Exact Mass | 342.14 |
| IUPAC Name | N-(4-benzylpiperidin-1-yl)-2-chloro-7H-purin-6-amine |
| SMILES | Clc1nc(NN2CCC(Cc3ccccc3)CC2)c2[nH]cnc2n1 |
| InChI | InChI=1S/C17H19ClN6/c18-17-21-15-14(19-11-20-15)16(22-17)23-24-8-6-13(7-9-24)10-12-4-2-1-3-5-12/h1-5,11,13H,6-10H2,(H2,19,20,21,22,23) |
| InChIKey | GJULISKSMSOFTK-UHFFFAOYSA-N |
| XLogP | 3.29 |
| TPSA | 69.73 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 342.83 |
| LogP ≤ 5 | 3.29 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |