C13H14ClN5 — CID 114096303
2-chloro-N-(3-tricyclo[3.2.1.02,4]octanyl)-7H-purin-6-amine (PubChem CID 114096303) has the molecular formula C13H14ClN5 and a molecular weight of 275.74 g/mol. Its IUPAC name is 2-chloro-N-(3-tricyclo[3.2.1.02,4]octanyl)-7H-purin-6-amine.
| Compound Name | 2-chloro-N-(3-tricyclo[3.2.1.02,4]octanyl)-7H-purin-6-amine |
|---|---|
| PubChem CID | 114096303 |
| Molecular Formula | C13H14ClN5 |
| Molecular Weight | 275.74 g/mol |
| Exact Mass | 275.09 |
| IUPAC Name | 2-chloro-N-(3-tricyclo[3.2.1.02,4]octanyl)-7H-purin-6-amine |
| SMILES | Clc1nc(NC2C3C4CCC(C4)C23)c2[nH]cnc2n1 |
| InChI | InChI=1S/C13H14ClN5/c14-13-18-11-10(15-4-16-11)12(19-13)17-9-7-5-1-2-6(3-5)8(7)9/h4-9H,1-3H2,(H2,15,16,17,18,19) |
| InChIKey | RECHBHIOXHBKTJ-UHFFFAOYSA-N |
| XLogP | 2.46 |
| TPSA | 66.49 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 275.74 |
| LogP ≤ 5 | 2.46 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |