C14H18ClN5 — CID 154927028
2-chloro-N-[di(cyclobutyl)methyl]-7H-purin-6-amine (PubChem CID 154927028) has the molecular formula C14H18ClN5 and a molecular weight of 291.79 g/mol. Its IUPAC name is 2-chloro-N-[di(cyclobutyl)methyl]-7H-purin-6-amine.
| Compound Name | 2-chloro-N-[di(cyclobutyl)methyl]-7H-purin-6-amine |
|---|---|
| PubChem CID | 154927028 |
| Molecular Formula | C14H18ClN5 |
| Molecular Weight | 291.79 g/mol |
| Exact Mass | 291.13 |
| IUPAC Name | 2-chloro-N-[di(cyclobutyl)methyl]-7H-purin-6-amine |
| SMILES | Clc1nc(NC(C2CCC2)C2CCC2)c2[nH]cnc2n1 |
| InChI | InChI=1S/C14H18ClN5/c15-14-19-12-11(16-7-17-12)13(20-14)18-10(8-3-1-4-8)9-5-2-6-9/h7-10H,1-6H2,(H2,16,17,18,19,20) |
| InChIKey | HIQSOTKJBODCNN-UHFFFAOYSA-N |
| XLogP | 3.39 |
| TPSA | 66.49 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 291.79 |
| LogP ≤ 5 | 3.39 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |