C12H19ClN6 — CID 104697639
2-N-(2-chloro-7H-purin-6-yl)-1-N,1-N-diethylpropane-1,2-diamine (PubChem CID 104697639) has the molecular formula C12H19ClN6 and a molecular weight of 282.78 g/mol. Its IUPAC name is 2-N-(2-chloro-7H-purin-6-yl)-1-N,1-N-diethylpropane-1,2-diamine.
| Compound Name | 2-N-(2-chloro-7H-purin-6-yl)-1-N,1-N-diethylpropane-1,2-diamine |
|---|---|
| PubChem CID | 104697639 |
| Molecular Formula | C12H19ClN6 |
| Molecular Weight | 282.78 g/mol |
| Exact Mass | 282.14 |
| IUPAC Name | 2-N-(2-chloro-7H-purin-6-yl)-1-N,1-N-diethylpropane-1,2-diamine |
| SMILES | CCN(CC)CC(C)Nc1nc(Cl)nc2nc[nH]c12 |
| InChI | InChI=1S/C12H19ClN6/c1-4-19(5-2)6-8(3)16-11-9-10(15-7-14-9)17-12(13)18-11/h7-8H,4-6H2,1-3H3,(H2,14,15,16,17,18) |
| InChIKey | DPJDLQRMNXFPLJ-UHFFFAOYSA-N |
| XLogP | 2.15 |
| TPSA | 69.73 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 282.78 |
| LogP ≤ 5 | 2.15 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |