C10H15N5 — CID 67967892
N-[(2R)-butan-2-yl]-2-methyl-7H-purin-6-amine (PubChem CID 67967892) has the molecular formula C10H15N5 and a molecular weight of 205.26 g/mol. Its IUPAC name is N-[(2R)-butan-2-yl]-2-methyl-7H-purin-6-amine.
| Compound Name | N-[(2R)-butan-2-yl]-2-methyl-7H-purin-6-amine |
|---|---|
| PubChem CID | 67967892 |
| Molecular Formula | C10H15N5 |
| Molecular Weight | 205.26 g/mol |
| Exact Mass | 205.13 |
| IUPAC Name | N-[(2R)-butan-2-yl]-2-methyl-7H-purin-6-amine |
| SMILES | CC[C@@H](C)Nc1nc(C)nc2nc[nH]c12 |
| InChI | InChI=1S/C10H15N5/c1-4-6(2)13-10-8-9(12-5-11-8)14-7(3)15-10/h5-6H,4H2,1-3H3,(H2,11,12,13,14,15)/t6-/m1/s1 |
| InChIKey | DZIPCPRKAKPGFS-ZCFIWIBFSA-N |
| XLogP | 1.87 |
| TPSA | 66.49 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 205.26 |
| LogP ≤ 5 | 1.87 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |