C12H13N7 — CID 118317169
2-methyl-N-[(6-methylpyrazin-2-yl)methyl]-7H-purin-6-amine (PubChem CID 118317169) has the molecular formula C12H13N7 and a molecular weight of 255.28 g/mol. Its IUPAC name is 2-methyl-N-[(6-methylpyrazin-2-yl)methyl]-7H-purin-6-amine.
| Compound Name | 2-methyl-N-[(6-methylpyrazin-2-yl)methyl]-7H-purin-6-amine |
|---|---|
| PubChem CID | 118317169 |
| Molecular Formula | C12H13N7 |
| Molecular Weight | 255.28 g/mol |
| Exact Mass | 255.12 |
| IUPAC Name | 2-methyl-N-[(6-methylpyrazin-2-yl)methyl]-7H-purin-6-amine |
| SMILES | Cc1cncc(CNc2nc(C)nc3nc[nH]c23)n1 |
| InChI | InChI=1S/C12H13N7/c1-7-3-13-4-9(17-7)5-14-11-10-12(16-6-15-10)19-8(2)18-11/h3-4,6H,5H2,1-2H3,(H2,14,15,16,18,19) |
| InChIKey | FFXJCGNMVRJVOI-UHFFFAOYSA-N |
| XLogP | 1.37 |
| TPSA | 92.27 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 255.28 |
| LogP ≤ 5 | 1.37 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |