C12H13N5O — CID 154596531
2-methyl-N-[(5-methylfuran-2-yl)methyl]-7H-purin-6-amine (PubChem CID 154596531) has the molecular formula C12H13N5O and a molecular weight of 243.27 g/mol. Its IUPAC name is 2-methyl-N-[(5-methylfuran-2-yl)methyl]-7H-purin-6-amine.
| Compound Name | 2-methyl-N-[(5-methylfuran-2-yl)methyl]-7H-purin-6-amine |
|---|---|
| PubChem CID | 154596531 |
| Molecular Formula | C12H13N5O |
| Molecular Weight | 243.27 g/mol |
| Exact Mass | 243.11 |
| IUPAC Name | 2-methyl-N-[(5-methylfuran-2-yl)methyl]-7H-purin-6-amine |
| SMILES | Cc1nc(NCc2ccc(C)o2)c2[nH]cnc2n1 |
| InChI | InChI=1S/C12H13N5O/c1-7-3-4-9(18-7)5-13-11-10-12(15-6-14-10)17-8(2)16-11/h3-4,6H,5H2,1-2H3,(H2,13,14,15,16,17) |
| InChIKey | XWTZBOAXGKIHNJ-UHFFFAOYSA-N |
| XLogP | 2.17 |
| TPSA | 79.63 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 243.27 |
| LogP ≤ 5 | 2.17 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |