C14H10ClN5O — CID 134481136
N-(1-benzofuran-2-ylmethyl)-2-chloro-7H-purin-6-amine (PubChem CID 134481136) has the molecular formula C14H10ClN5O and a molecular weight of 299.72 g/mol. Its IUPAC name is N-(1-benzofuran-2-ylmethyl)-2-chloro-7H-purin-6-amine.
| Compound Name | N-(1-benzofuran-2-ylmethyl)-2-chloro-7H-purin-6-amine |
|---|---|
| PubChem CID | 134481136 |
| Molecular Formula | C14H10ClN5O |
| Molecular Weight | 299.72 g/mol |
| Exact Mass | 299.06 |
| IUPAC Name | N-(1-benzofuran-2-ylmethyl)-2-chloro-7H-purin-6-amine |
| SMILES | Clc1nc(NCc2cc3ccccc3o2)c2[nH]cnc2n1 |
| InChI | InChI=1S/C14H10ClN5O/c15-14-19-12(11-13(20-14)18-7-17-11)16-6-9-5-8-3-1-2-4-10(8)21-9/h1-5,7H,6H2,(H2,16,17,18,19,20) |
| InChIKey | NRTQIWCASSGXDJ-UHFFFAOYSA-N |
| XLogP | 3.36 |
| TPSA | 79.63 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 299.72 |
| LogP ≤ 5 | 3.36 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |