C9H7ClN6O — CID 167800154
2-chloro-N-(1,3-oxazol-2-ylmethyl)-7H-purin-6-amine (PubChem CID 167800154) has the molecular formula C9H7ClN6O and a molecular weight of 250.65 g/mol. Its IUPAC name is 2-chloro-N-(1,3-oxazol-2-ylmethyl)-7H-purin-6-amine.
| Compound Name | 2-chloro-N-(1,3-oxazol-2-ylmethyl)-7H-purin-6-amine |
|---|---|
| PubChem CID | 167800154 |
| Molecular Formula | C9H7ClN6O |
| Molecular Weight | 250.65 g/mol |
| Exact Mass | 250.04 |
| IUPAC Name | 2-chloro-N-(1,3-oxazol-2-ylmethyl)-7H-purin-6-amine |
| SMILES | Clc1nc(NCc2ncco2)c2[nH]cnc2n1 |
| InChI | InChI=1S/C9H7ClN6O/c10-9-15-7(6-8(16-9)14-4-13-6)12-3-5-11-1-2-17-5/h1-2,4H,3H2,(H2,12,13,14,15,16) |
| InChIKey | CZAREQLLCOSTCF-UHFFFAOYSA-N |
| XLogP | 1.61 |
| TPSA | 92.52 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 250.65 |
| LogP ≤ 5 | 1.61 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |