C10H7ClF3N7 — CID 167987617
2-chloro-N-[[3-(trifluoromethyl)-1H-pyrazol-5-yl]methyl]-7H-purin-6-amine (PubChem CID 167987617) has the molecular formula C10H7ClF3N7 and a molecular weight of 317.66 g/mol. Its IUPAC name is 2-chloro-N-[[3-(trifluoromethyl)-1H-pyrazol-5-yl]methyl]-7H-purin-6-amine.
| Compound Name | 2-chloro-N-[[3-(trifluoromethyl)-1H-pyrazol-5-yl]methyl]-7H-purin-6-amine |
|---|---|
| PubChem CID | 167987617 |
| Molecular Formula | C10H7ClF3N7 |
| Molecular Weight | 317.66 g/mol |
| Exact Mass | 317.04 |
| IUPAC Name | 2-chloro-N-[[3-(trifluoromethyl)-1H-pyrazol-5-yl]methyl]-7H-purin-6-amine |
| SMILES | FC(F)(F)c1cc(CNc2nc(Cl)nc3nc[nH]c23)[nH]n1 |
| InChI | InChI=1S/C10H7ClF3N7/c11-9-18-7(6-8(19-9)17-3-16-6)15-2-4-1-5(21-20-4)10(12,13)14/h1,3H,2H2,(H,20,21)(H2,15,16,17,18,19) |
| InChIKey | KZJFHZGTHBUOOT-UHFFFAOYSA-N |
| XLogP | 2.36 |
| TPSA | 95.17 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 317.66 |
| LogP ≤ 5 | 2.36 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |