C12H12ClN5S — CID 113442692
2-chloro-N-[(4,5-dimethylthiophen-2-yl)methyl]-7H-purin-6-amine (PubChem CID 113442692) has the molecular formula C12H12ClN5S and a molecular weight of 293.78 g/mol. Its IUPAC name is 2-chloro-N-[(4,5-dimethylthiophen-2-yl)methyl]-7H-purin-6-amine.
| Compound Name | 2-chloro-N-[(4,5-dimethylthiophen-2-yl)methyl]-7H-purin-6-amine |
|---|---|
| PubChem CID | 113442692 |
| Molecular Formula | C12H12ClN5S |
| Molecular Weight | 293.78 g/mol |
| Exact Mass | 293.05 |
| IUPAC Name | 2-chloro-N-[(4,5-dimethylthiophen-2-yl)methyl]-7H-purin-6-amine |
| SMILES | Cc1cc(CNc2nc(Cl)nc3nc[nH]c23)sc1C |
| InChI | InChI=1S/C12H12ClN5S/c1-6-3-8(19-7(6)2)4-14-10-9-11(16-5-15-9)18-12(13)17-10/h3,5H,4H2,1-2H3,(H2,14,15,16,17,18) |
| InChIKey | DBJYTSMDTHAKLQ-UHFFFAOYSA-N |
| XLogP | 3.30 |
| TPSA | 66.49 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 293.78 |
| LogP ≤ 5 | 3.30 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |