C10H9ClN6O — CID 167746406
2-chloro-N-[(2-methyl-1,3-oxazol-5-yl)methyl]-7H-purin-6-amine (PubChem CID 167746406) has the molecular formula C10H9ClN6O and a molecular weight of 264.68 g/mol. Its IUPAC name is 2-chloro-N-[(2-methyl-1,3-oxazol-5-yl)methyl]-7H-purin-6-amine.
| Compound Name | 2-chloro-N-[(2-methyl-1,3-oxazol-5-yl)methyl]-7H-purin-6-amine |
|---|---|
| PubChem CID | 167746406 |
| Molecular Formula | C10H9ClN6O |
| Molecular Weight | 264.68 g/mol |
| Exact Mass | 264.05 |
| IUPAC Name | 2-chloro-N-[(2-methyl-1,3-oxazol-5-yl)methyl]-7H-purin-6-amine |
| SMILES | Cc1ncc(CNc2nc(Cl)nc3nc[nH]c23)o1 |
| InChI | InChI=1S/C10H9ClN6O/c1-5-12-2-6(18-5)3-13-8-7-9(15-4-14-7)17-10(11)16-8/h2,4H,3H2,1H3,(H2,13,14,15,16,17) |
| InChIKey | LUFREYFJPRQDDH-UHFFFAOYSA-N |
| XLogP | 1.91 |
| TPSA | 92.52 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 264.68 |
| LogP ≤ 5 | 1.91 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |