C9H12ClN5O — CID 104697509
2-chloro-N-(2-ethoxyethyl)-7H-purin-6-amine (PubChem CID 104697509) has the molecular formula C9H12ClN5O and a molecular weight of 241.68 g/mol. Its IUPAC name is 2-chloro-N-(2-ethoxyethyl)-7H-purin-6-amine.
| Compound Name | 2-chloro-N-(2-ethoxyethyl)-7H-purin-6-amine |
|---|---|
| PubChem CID | 104697509 |
| Molecular Formula | C9H12ClN5O |
| Molecular Weight | 241.68 g/mol |
| Exact Mass | 241.07 |
| IUPAC Name | 2-chloro-N-(2-ethoxyethyl)-7H-purin-6-amine |
| SMILES | CCOCCNc1nc(Cl)nc2nc[nH]c12 |
| InChI | InChI=1S/C9H12ClN5O/c1-2-16-4-3-11-7-6-8(13-5-12-6)15-9(10)14-7/h5H,2-4H2,1H3,(H2,11,12,13,14,15) |
| InChIKey | DNROYVSVCABSBK-UHFFFAOYSA-N |
| XLogP | 1.45 |
| TPSA | 75.72 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 241.68 |
| LogP ≤ 5 | 1.45 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|