C9H12ClN5O2 — CID 104697715
1-[(2-chloro-7H-purin-6-yl)amino]-3-methoxypropan-2-ol (PubChem CID 104697715) has the molecular formula C9H12ClN5O2 and a molecular weight of 257.68 g/mol. Its IUPAC name is 1-[(2-chloro-7H-purin-6-yl)amino]-3-methoxypropan-2-ol.
| Compound Name | 1-[(2-chloro-7H-purin-6-yl)amino]-3-methoxypropan-2-ol |
|---|---|
| PubChem CID | 104697715 |
| Molecular Formula | C9H12ClN5O2 |
| Molecular Weight | 257.68 g/mol |
| Exact Mass | 257.07 |
| IUPAC Name | 1-[(2-chloro-7H-purin-6-yl)amino]-3-methoxypropan-2-ol |
| SMILES | COCC(O)CNc1nc(Cl)nc2nc[nH]c12 |
| InChI | InChI=1S/C9H12ClN5O2/c1-17-3-5(16)2-11-7-6-8(13-4-12-6)15-9(10)14-7/h4-5,16H,2-3H2,1H3,(H2,11,12,13,14,15) |
| InChIKey | NPHGUZLKBQNHTA-UHFFFAOYSA-N |
| XLogP | 0.43 |
| TPSA | 95.95 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 257.68 |
| LogP ≤ 5 | 0.43 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |