C10H14ClN5O2 — CID 114152161
3-[(2-chloro-7H-purin-6-yl)amino]-4-methoxybutan-1-ol (PubChem CID 114152161) has the molecular formula C10H14ClN5O2 and a molecular weight of 271.71 g/mol. Its IUPAC name is 3-[(2-chloro-7H-purin-6-yl)amino]-4-methoxybutan-1-ol.
| Compound Name | 3-[(2-chloro-7H-purin-6-yl)amino]-4-methoxybutan-1-ol |
|---|---|
| PubChem CID | 114152161 |
| Molecular Formula | C10H14ClN5O2 |
| Molecular Weight | 271.71 g/mol |
| Exact Mass | 271.08 |
| IUPAC Name | 3-[(2-chloro-7H-purin-6-yl)amino]-4-methoxybutan-1-ol |
| SMILES | COCC(CCO)Nc1nc(Cl)nc2nc[nH]c12 |
| InChI | InChI=1S/C10H14ClN5O2/c1-18-4-6(2-3-17)14-9-7-8(13-5-12-7)15-10(11)16-9/h5-6,17H,2-4H2,1H3,(H2,12,13,14,15,16) |
| InChIKey | WBTAHMJAPYHJMT-UHFFFAOYSA-N |
| XLogP | 0.82 |
| TPSA | 95.95 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 271.71 |
| LogP ≤ 5 | 0.82 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |