C12H20N6O — CID 114785349
2-N-ethyl-6-N-(1-methoxybutan-2-yl)-7H-purine-2,6-diamine (PubChem CID 114785349) has the molecular formula C12H20N6O and a molecular weight of 264.33 g/mol. Its IUPAC name is 2-N-ethyl-6-N-(1-methoxybutan-2-yl)-7H-purine-2,6-diamine.
| Compound Name | 2-N-ethyl-6-N-(1-methoxybutan-2-yl)-7H-purine-2,6-diamine |
|---|---|
| PubChem CID | 114785349 |
| Molecular Formula | C12H20N6O |
| Molecular Weight | 264.33 g/mol |
| Exact Mass | 264.17 |
| IUPAC Name | 2-N-ethyl-6-N-(1-methoxybutan-2-yl)-7H-purine-2,6-diamine |
| SMILES | CCNc1nc(NC(CC)COC)c2[nH]cnc2n1 |
| InChI | InChI=1S/C12H20N6O/c1-4-8(6-19-3)16-11-9-10(15-7-14-9)17-12(18-11)13-5-2/h7-8H,4-6H2,1-3H3,(H3,13,14,15,16,17,18) |
| InChIKey | LIPHJNDFVMIMLF-UHFFFAOYSA-N |
| XLogP | 1.62 |
| TPSA | 87.75 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 264.33 |
| LogP ≤ 5 | 1.62 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |