C14H24N6O — CID 114786369
6-N-(3-butoxypropyl)-2-N-ethyl-7H-purine-2,6-diamine (PubChem CID 114786369) has the molecular formula C14H24N6O and a molecular weight of 292.39 g/mol. Its IUPAC name is 6-N-(3-butoxypropyl)-2-N-ethyl-7H-purine-2,6-diamine.
| Compound Name | 6-N-(3-butoxypropyl)-2-N-ethyl-7H-purine-2,6-diamine |
|---|---|
| PubChem CID | 114786369 |
| Molecular Formula | C14H24N6O |
| Molecular Weight | 292.39 g/mol |
| Exact Mass | 292.20 |
| IUPAC Name | 6-N-(3-butoxypropyl)-2-N-ethyl-7H-purine-2,6-diamine |
| SMILES | CCCCOCCCNc1nc(NCC)nc2nc[nH]c12 |
| InChI | InChI=1S/C14H24N6O/c1-3-5-8-21-9-6-7-16-12-11-13(18-10-17-11)20-14(19-12)15-4-2/h10H,3-9H2,1-2H3,(H3,15,16,17,18,19,20) |
| InChIKey | MTVZRXJSLZTXDR-UHFFFAOYSA-N |
| XLogP | 2.40 |
| TPSA | 87.75 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 292.39 |
| LogP ≤ 5 | 2.40 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|