C15H26N6 — CID 114783314
6-N,6-N-dibutyl-2-N-ethyl-7H-purine-2,6-diamine (PubChem CID 114783314) has the molecular formula C15H26N6 and a molecular weight of 290.42 g/mol. Its IUPAC name is 6-N,6-N-dibutyl-2-N-ethyl-7H-purine-2,6-diamine.
| Compound Name | 6-N,6-N-dibutyl-2-N-ethyl-7H-purine-2,6-diamine |
|---|---|
| PubChem CID | 114783314 |
| Molecular Formula | C15H26N6 |
| Molecular Weight | 290.42 g/mol |
| Exact Mass | 290.22 |
| IUPAC Name | 6-N,6-N-dibutyl-2-N-ethyl-7H-purine-2,6-diamine |
| SMILES | CCCCN(CCCC)c1nc(NCC)nc2nc[nH]c12 |
| InChI | InChI=1S/C15H26N6/c1-4-7-9-21(10-8-5-2)14-12-13(18-11-17-12)19-15(20-14)16-6-3/h11H,4-10H2,1-3H3,(H2,16,17,18,19,20) |
| InChIKey | KYTOIJAFMBSWIH-UHFFFAOYSA-N |
| XLogP | 3.19 |
| TPSA | 69.73 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 290.42 |
| LogP ≤ 5 | 3.19 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |