C13H21N7O — CID 114784196
2-[[2-(ethylamino)-7H-purin-6-yl]-methylamino]-N-propylacetamide (PubChem CID 114784196) has the molecular formula C13H21N7O and a molecular weight of 291.36 g/mol. Its IUPAC name is 2-[[2-(ethylamino)-7H-purin-6-yl]-methylamino]-N-propylacetamide.
| Compound Name | 2-[[2-(ethylamino)-7H-purin-6-yl]-methylamino]-N-propylacetamide |
|---|---|
| PubChem CID | 114784196 |
| Molecular Formula | C13H21N7O |
| Molecular Weight | 291.36 g/mol |
| Exact Mass | 291.18 |
| IUPAC Name | 2-[[2-(ethylamino)-7H-purin-6-yl]-methylamino]-N-propylacetamide |
| SMILES | CCCNC(=O)CN(C)c1nc(NCC)nc2nc[nH]c12 |
| InChI | InChI=1S/C13H21N7O/c1-4-6-15-9(21)7-20(3)12-10-11(17-8-16-10)18-13(19-12)14-5-2/h8H,4-7H2,1-3H3,(H,15,21)(H2,14,16,17,18,19) |
| InChIKey | DWRXHQKLJSDYHA-UHFFFAOYSA-N |
| XLogP | 0.75 |
| TPSA | 98.83 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 291.36 |
| LogP ≤ 5 | 0.75 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |