C14H23N7O — CID 119643710
N-(2-amino-2-ethylbutyl)-2-[methyl(7H-purin-6-yl)amino]acetamide (PubChem CID 119643710) has the molecular formula C14H23N7O and a molecular weight of 305.39 g/mol. Its IUPAC name is N-(2-amino-2-ethylbutyl)-2-[methyl(7H-purin-6-yl)amino]acetamide.
| Compound Name | N-(2-amino-2-ethylbutyl)-2-[methyl(7H-purin-6-yl)amino]acetamide |
|---|---|
| PubChem CID | 119643710 |
| Molecular Formula | C14H23N7O |
| Molecular Weight | 305.39 g/mol |
| Exact Mass | 305.20 |
| IUPAC Name | N-(2-amino-2-ethylbutyl)-2-[methyl(7H-purin-6-yl)amino]acetamide |
| SMILES | CCC(N)(CC)CNC(=O)CN(C)c1ncnc2nc[nH]c12 |
| InChI | InChI=1S/C14H23N7O/c1-4-14(15,5-2)7-16-10(22)6-21(3)13-11-12(18-8-17-11)19-9-20-13/h8-9H,4-7,15H2,1-3H3,(H,16,22)(H,17,18,19,20) |
| InChIKey | BJSLAYMKYVZBBN-UHFFFAOYSA-N |
| XLogP | 0.42 |
| TPSA | 112.82 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 305.39 |
| LogP ≤ 5 | 0.42 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |