C14H25Cl2N7O — CID 119668576
N-(1-aminohexan-2-yl)-2-[methyl(7H-purin-6-yl)amino]acetamide;dihydrochloride (PubChem CID 119668576) has the molecular formula C14H25Cl2N7O and a molecular weight of 378.31 g/mol. Its IUPAC name is N-(1-aminohexan-2-yl)-2-[methyl(7H-purin-6-yl)amino]acetamide;dihydrochloride.
| Compound Name | N-(1-aminohexan-2-yl)-2-[methyl(7H-purin-6-yl)amino]acetamide;dihydrochloride |
|---|---|
| PubChem CID | 119668576 |
| Molecular Formula | C14H25Cl2N7O |
| Molecular Weight | 378.31 g/mol |
| Exact Mass | 377.15 |
| IUPAC Name | N-(1-aminohexan-2-yl)-2-[methyl(7H-purin-6-yl)amino]acetamide;dihydrochloride |
| SMILES | CCCCC(CN)NC(=O)CN(C)c1ncnc2nc[nH]c12.Cl.Cl |
| InChI | InChI=1S/C14H23N7O.2ClH/c1-3-4-5-10(6-15)20-11(22)7-21(2)14-12-13(17-8-16-12)18-9-19-14;;/h8-10H,3-7,15H2,1-2H3,(H,20,22)(H,16,17,18,19);2*1H |
| InChIKey | DGLBZCYCDLOBCP-UHFFFAOYSA-N |
| XLogP | 1.27 |
| TPSA | 112.82 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 378.31 |
| LogP ≤ 5 | 1.27 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |