C12H16N6O3 — CID 119362648
3-[methyl-[2-[methyl(7H-purin-6-yl)amino]acetyl]amino]propanoic acid (PubChem CID 119362648) has the molecular formula C12H16N6O3 and a molecular weight of 292.30 g/mol. Its IUPAC name is 3-[methyl-[2-[methyl(7H-purin-6-yl)amino]acetyl]amino]propanoic acid.
| Compound Name | 3-[methyl-[2-[methyl(7H-purin-6-yl)amino]acetyl]amino]propanoic acid |
|---|---|
| PubChem CID | 119362648 |
| Molecular Formula | C12H16N6O3 |
| Molecular Weight | 292.30 g/mol |
| Exact Mass | 292.13 |
| IUPAC Name | 3-[methyl-[2-[methyl(7H-purin-6-yl)amino]acetyl]amino]propanoic acid |
| SMILES | CN(CCC(=O)O)C(=O)CN(C)c1ncnc2nc[nH]c12 |
| InChI | InChI=1S/C12H16N6O3/c1-17(4-3-9(20)21)8(19)5-18(2)12-10-11(14-6-13-10)15-7-16-12/h6-7H,3-5H2,1-2H3,(H,20,21)(H,13,14,15,16) |
| InChIKey | SOIMKXBYMPWSGN-UHFFFAOYSA-N |
| XLogP | -0.28 |
| TPSA | 115.31 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 292.30 |
| LogP ≤ 5 | -0.28 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |