C10H14ClN5 — CID 13285773
N-(4-chlorobutyl)-N-methyl-7H-purin-6-amine (PubChem CID 13285773) has the molecular formula C10H14ClN5 and a molecular weight of 239.71 g/mol. Its IUPAC name is N-(4-chlorobutyl)-N-methyl-7H-purin-6-amine.
| Compound Name | N-(4-chlorobutyl)-N-methyl-7H-purin-6-amine |
|---|---|
| PubChem CID | 13285773 |
| Molecular Formula | C10H14ClN5 |
| Molecular Weight | 239.71 g/mol |
| Exact Mass | 239.09 |
| IUPAC Name | N-(4-chlorobutyl)-N-methyl-7H-purin-6-amine |
| SMILES | CN(CCCCCl)c1ncnc2nc[nH]c12 |
| InChI | InChI=1S/C10H14ClN5/c1-16(5-3-2-4-11)10-8-9(13-6-12-8)14-7-15-10/h6-7H,2-5H2,1H3,(H,12,13,14,15) |
| InChIKey | RRTYIYFFXQYTIX-UHFFFAOYSA-N |
| XLogP | 1.81 |
| TPSA | 57.70 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 239.71 |
| LogP ≤ 5 | 1.81 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|