C12H15N7 — CID 45216939
N-methyl-N-[2-(2-methylimidazol-1-yl)ethyl]-7H-purin-6-amine (PubChem CID 45216939) has the molecular formula C12H15N7 and a molecular weight of 257.30 g/mol. Its IUPAC name is N-methyl-N-[2-(2-methylimidazol-1-yl)ethyl]-7H-purin-6-amine.
| Compound Name | N-methyl-N-[2-(2-methylimidazol-1-yl)ethyl]-7H-purin-6-amine |
|---|---|
| PubChem CID | 45216939 |
| Molecular Formula | C12H15N7 |
| Molecular Weight | 257.30 g/mol |
| Exact Mass | 257.14 |
| IUPAC Name | N-methyl-N-[2-(2-methylimidazol-1-yl)ethyl]-7H-purin-6-amine |
| SMILES | Cc1nccn1CCN(C)c1ncnc2nc[nH]c12 |
| InChI | InChI=1S/C12H15N7/c1-9-13-3-4-19(9)6-5-18(2)12-10-11(15-7-14-10)16-8-17-12/h3-4,7-8H,5-6H2,1-2H3,(H,14,15,16,17) |
| InChIKey | AILJQDUIEDOLFH-UHFFFAOYSA-N |
| XLogP | 0.99 |
| TPSA | 75.52 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 257.30 |
| LogP ≤ 5 | 0.99 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |