C7H11N7 — CID 66676633
N,N-bis(methylamino)-7H-purin-6-amine (PubChem CID 66676633) has the molecular formula C7H11N7 and a molecular weight of 193.21 g/mol. Its IUPAC name is N,N-bis(methylamino)-7H-purin-6-amine.
| Compound Name | N,N-bis(methylamino)-7H-purin-6-amine |
|---|---|
| PubChem CID | 66676633 |
| Molecular Formula | C7H11N7 |
| Molecular Weight | 193.21 g/mol |
| Exact Mass | 193.11 |
| IUPAC Name | N,N-bis(methylamino)-7H-purin-6-amine |
| SMILES | CNN(NC)c1ncnc2nc[nH]c12 |
| InChI | InChI=1S/C7H11N7/c1-8-14(9-2)7-5-6(11-3-10-5)12-4-13-7/h3-4,8-9H,1-2H3,(H,10,11,12,13) |
| InChIKey | LMQNVRFPSDEUFK-UHFFFAOYSA-N |
| XLogP | -0.57 |
| TPSA | 81.76 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 193.21 |
| LogP ≤ 5 | -0.57 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|