About N'-(2-methylpropyl)-N'-(7H-purin-6-yl)ethane-1,2-diamine
N'-(2-methylpropyl)-N'-(7H-purin-6-yl)ethane-1,2-diamine (PubChem CID 55091105) has the molecular formula C11H18N6
and a molecular weight of 234.31 g/mol. Its IUPAC name is N'-(2-methylpropyl)-N'-(7H-purin-6-yl)ethane-1,2-diamine.
Molecular Properties
| Compound Name | N'-(2-methylpropyl)-N'-(7H-purin-6-yl)ethane-1,2-diamine |
| PubChem CID | 55091105 |
| Molecular Formula | C11H18N6 |
| Molecular Weight | 234.31 g/mol |
| Exact Mass | 234.16 |
| IUPAC Name | N'-(2-methylpropyl)-N'-(7H-purin-6-yl)ethane-1,2-diamine |
| SMILES | CC(C)CN(CCN)c1ncnc2nc[nH]c12 |
| InChI | InChI=1S/C11H18N6/c1-8(2)5-17(4-3-12)11-9-10(14-6-13-9)15-7-16-11/h6-8H,3-5,12H2,1-2H3,(H,13,14,15,16) |
| InChIKey | BJAYAIKIYRICQL-UHFFFAOYSA-N |
| XLogP | 0.77 |
| TPSA | 83.72 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 17 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 234.31 |
| LogP ≤ 5 | 0.77 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
Analyze N'-(2-methylpropyl)-N'-(7H-purin-6-yl)ethane-1,2-diamine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N'-(2-methylpropyl)-N'-(7H-purin-6-yl)ethane-1,2-diamine?
The IUPAC name of N'-(2-methylpropyl)-N'-(7H-purin-6-yl)ethane-1,2-diamine (CID 55091105) is N'-(2-methylpropyl)-N'-(7H-purin-6-yl)ethane-1,2-diamine.
What is the SMILES notation for N'-(2-methylpropyl)-N'-(7H-purin-6-yl)ethane-1,2-diamine?
The canonical SMILES for N'-(2-methylpropyl)-N'-(7H-purin-6-yl)ethane-1,2-diamine is CC(C)CN(CCN)c1ncnc2nc[nH]c12.
What is the InChIKey of N'-(2-methylpropyl)-N'-(7H-purin-6-yl)ethane-1,2-diamine?
The InChIKey is BJAYAIKIYRICQL-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H18N6/c1-8(2)5-17(4-3-12)11-9-10(14-6-13-9)15-7-16-11/h6-8H,3-5,12H2,1-2H3,(H,13,14,15,16).
What are the key properties of N'-(2-methylpropyl)-N'-(7H-purin-6-yl)ethane-1,2-diamine?
N'-(2-methylpropyl)-N'-(7H-purin-6-yl)ethane-1,2-diamine has a molecular weight of 234.31 g/mol, XLogP of 0.77, 5 rotatable bonds, 2 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for N'-(2-methylpropyl)-N'-(7H-purin-6-yl)ethane-1,2-diamine is sourced from PubChem (CID 55091105), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).