C14H16N6 — CID 61013592
N'-benzyl-N'-(7H-purin-6-yl)ethane-1,2-diamine (PubChem CID 61013592) has the molecular formula C14H16N6 and a molecular weight of 268.32 g/mol. Its IUPAC name is N'-benzyl-N'-(7H-purin-6-yl)ethane-1,2-diamine.
| Compound Name | N'-benzyl-N'-(7H-purin-6-yl)ethane-1,2-diamine |
|---|---|
| PubChem CID | 61013592 |
| Molecular Formula | C14H16N6 |
| Molecular Weight | 268.32 g/mol |
| Exact Mass | 268.14 |
| IUPAC Name | N'-benzyl-N'-(7H-purin-6-yl)ethane-1,2-diamine |
| SMILES | NCCN(Cc1ccccc1)c1ncnc2nc[nH]c12 |
| InChI | InChI=1S/C14H16N6/c15-6-7-20(8-11-4-2-1-3-5-11)14-12-13(17-9-16-12)18-10-19-14/h1-5,9-10H,6-8,15H2,(H,16,17,18,19) |
| InChIKey | QGLABSTXFUQZFO-UHFFFAOYSA-N |
| XLogP | 1.32 |
| TPSA | 83.72 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 268.32 |
| LogP ≤ 5 | 1.32 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |