C12H13N5OS — CID 133403413
2-[7H-purin-6-yl(thiophen-3-ylmethyl)amino]ethanol (PubChem CID 133403413) has the molecular formula C12H13N5OS and a molecular weight of 275.34 g/mol. Its IUPAC name is 2-[7H-purin-6-yl(thiophen-3-ylmethyl)amino]ethanol.
| Compound Name | 2-[7H-purin-6-yl(thiophen-3-ylmethyl)amino]ethanol |
|---|---|
| PubChem CID | 133403413 |
| Molecular Formula | C12H13N5OS |
| Molecular Weight | 275.34 g/mol |
| Exact Mass | 275.08 |
| IUPAC Name | 2-[7H-purin-6-yl(thiophen-3-ylmethyl)amino]ethanol |
| SMILES | OCCN(Cc1ccsc1)c1ncnc2nc[nH]c12 |
| InChI | InChI=1S/C12H13N5OS/c18-3-2-17(5-9-1-4-19-6-9)12-10-11(14-7-13-10)15-8-16-12/h1,4,6-8,18H,2-3,5H2,(H,13,14,15,16) |
| InChIKey | NPIFAUBTPYBBTB-UHFFFAOYSA-N |
| XLogP | 1.41 |
| TPSA | 77.93 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 275.34 |
| LogP ≤ 5 | 1.41 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |