C8H12N6 — CID 62593872
N'-methyl-N'-(7H-purin-6-yl)ethane-1,2-diamine (PubChem CID 62593872) has the molecular formula C8H12N6 and a molecular weight of 192.23 g/mol. Its IUPAC name is N'-methyl-N'-(7H-purin-6-yl)ethane-1,2-diamine.
| Compound Name | N'-methyl-N'-(7H-purin-6-yl)ethane-1,2-diamine |
|---|---|
| PubChem CID | 62593872 |
| Molecular Formula | C8H12N6 |
| Molecular Weight | 192.23 g/mol |
| Exact Mass | 192.11 |
| IUPAC Name | N'-methyl-N'-(7H-purin-6-yl)ethane-1,2-diamine |
| SMILES | CN(CCN)c1ncnc2nc[nH]c12 |
| InChI | InChI=1S/C8H12N6/c1-14(3-2-9)8-6-7(11-4-10-6)12-5-13-8/h4-5H,2-3,9H2,1H3,(H,10,11,12,13) |
| InChIKey | IPKOQGHKPLSUIG-UHFFFAOYSA-N |
| XLogP | -0.25 |
| TPSA | 83.72 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 192.23 |
| LogP ≤ 5 | -0.25 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |