C11H18N6 — CID 54987903
N'-ethyl-2-methyl-N'-(7H-purin-6-yl)propane-1,3-diamine (PubChem CID 54987903) has the molecular formula C11H18N6 and a molecular weight of 234.31 g/mol. Its IUPAC name is N'-ethyl-2-methyl-N'-(7H-purin-6-yl)propane-1,3-diamine.
| Compound Name | N'-ethyl-2-methyl-N'-(7H-purin-6-yl)propane-1,3-diamine |
|---|---|
| PubChem CID | 54987903 |
| Molecular Formula | C11H18N6 |
| Molecular Weight | 234.31 g/mol |
| Exact Mass | 234.16 |
| IUPAC Name | N'-ethyl-2-methyl-N'-(7H-purin-6-yl)propane-1,3-diamine |
| SMILES | CCN(CC(C)CN)c1ncnc2nc[nH]c12 |
| InChI | InChI=1S/C11H18N6/c1-3-17(5-8(2)4-12)11-9-10(14-6-13-9)15-7-16-11/h6-8H,3-5,12H2,1-2H3,(H,13,14,15,16) |
| InChIKey | DCDLUQNJGIRARM-UHFFFAOYSA-N |
| XLogP | 0.77 |
| TPSA | 83.72 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 234.31 |
| LogP ≤ 5 | 0.77 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |