C12H17N5O2 — CID 62004761
ethyl 2-[propyl(7H-purin-6-yl)amino]acetate (PubChem CID 62004761) has the molecular formula C12H17N5O2 and a molecular weight of 263.30 g/mol. Its IUPAC name is ethyl 2-[propyl(7H-purin-6-yl)amino]acetate.
| Compound Name | ethyl 2-[propyl(7H-purin-6-yl)amino]acetate |
|---|---|
| PubChem CID | 62004761 |
| Molecular Formula | C12H17N5O2 |
| Molecular Weight | 263.30 g/mol |
| Exact Mass | 263.14 |
| IUPAC Name | ethyl 2-[propyl(7H-purin-6-yl)amino]acetate |
| SMILES | CCCN(CC(=O)OCC)c1ncnc2nc[nH]c12 |
| InChI | InChI=1S/C12H17N5O2/c1-3-5-17(6-9(18)19-4-2)12-10-11(14-7-13-10)15-8-16-12/h7-8H,3-6H2,1-2H3,(H,13,14,15,16) |
| InChIKey | LXXQMFVOJYXEJE-UHFFFAOYSA-N |
| XLogP | 1.13 |
| TPSA | 84.00 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 263.30 |
| LogP ≤ 5 | 1.13 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |