C16H25N7O — CID 119826160
2-[methyl(7H-purin-6-yl)amino]-N-piperidin-4-yl-N-propylacetamide (PubChem CID 119826160) has the molecular formula C16H25N7O and a molecular weight of 331.42 g/mol. Its IUPAC name is 2-[methyl(7H-purin-6-yl)amino]-N-piperidin-4-yl-N-propylacetamide.
| Compound Name | 2-[methyl(7H-purin-6-yl)amino]-N-piperidin-4-yl-N-propylacetamide |
|---|---|
| PubChem CID | 119826160 |
| Molecular Formula | C16H25N7O |
| Molecular Weight | 331.42 g/mol |
| Exact Mass | 331.21 |
| IUPAC Name | 2-[methyl(7H-purin-6-yl)amino]-N-piperidin-4-yl-N-propylacetamide |
| SMILES | CCCN(C(=O)CN(C)c1ncnc2nc[nH]c12)C1CCNCC1 |
| InChI | InChI=1S/C16H25N7O/c1-3-8-23(12-4-6-17-7-5-12)13(24)9-22(2)16-14-15(19-10-18-14)20-11-21-16/h10-12,17H,3-9H2,1-2H3,(H,18,19,20,21) |
| InChIKey | OYOWRFCQIXPTEB-UHFFFAOYSA-N |
| XLogP | 0.78 |
| TPSA | 90.04 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 331.42 |
| LogP ≤ 5 | 0.78 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |