C15H18N6O2 — CID 75479909
N-methyl-N-[(2-methylfuran-3-yl)methyl]-2-[methyl(7H-purin-6-yl)amino]acetamide (PubChem CID 75479909) has the molecular formula C15H18N6O2 and a molecular weight of 314.35 g/mol. Its IUPAC name is N-methyl-N-[(2-methylfuran-3-yl)methyl]-2-[methyl(7H-purin-6-yl)amino]acetamide.
| Compound Name | N-methyl-N-[(2-methylfuran-3-yl)methyl]-2-[methyl(7H-purin-6-yl)amino]acetamide |
|---|---|
| PubChem CID | 75479909 |
| Molecular Formula | C15H18N6O2 |
| Molecular Weight | 314.35 g/mol |
| Exact Mass | 314.15 |
| IUPAC Name | N-methyl-N-[(2-methylfuran-3-yl)methyl]-2-[methyl(7H-purin-6-yl)amino]acetamide |
| SMILES | Cc1occc1CN(C)C(=O)CN(C)c1ncnc2nc[nH]c12 |
| InChI | InChI=1S/C15H18N6O2/c1-10-11(4-5-23-10)6-20(2)12(22)7-21(3)15-13-14(17-8-16-13)18-9-19-15/h4-5,8-9H,6-7H2,1-3H3,(H,16,17,18,19) |
| InChIKey | QTCYRVXURHULSP-UHFFFAOYSA-N |
| XLogP | 1.35 |
| TPSA | 91.15 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 314.35 |
| LogP ≤ 5 | 1.35 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |