C14H15N7O — CID 167835478
2-[methyl(7H-purin-6-yl)amino]-N-(5-methyl-2-pyridinyl)acetamide (PubChem CID 167835478) has the molecular formula C14H15N7O and a molecular weight of 297.32 g/mol. Its IUPAC name is 2-[methyl(7H-purin-6-yl)amino]-N-(5-methyl-2-pyridinyl)acetamide.
| Compound Name | 2-[methyl(7H-purin-6-yl)amino]-N-(5-methyl-2-pyridinyl)acetamide |
|---|---|
| PubChem CID | 167835478 |
| Molecular Formula | C14H15N7O |
| Molecular Weight | 297.32 g/mol |
| Exact Mass | 297.13 |
| IUPAC Name | 2-[methyl(7H-purin-6-yl)amino]-N-(5-methyl-2-pyridinyl)acetamide |
| SMILES | Cc1ccc(NC(=O)CN(C)c2ncnc3nc[nH]c23)nc1 |
| InChI | InChI=1S/C14H15N7O/c1-9-3-4-10(15-5-9)20-11(22)6-21(2)14-12-13(17-7-16-12)18-8-19-14/h3-5,7-8H,6H2,1-2H3,(H,15,20,22)(H,16,17,18,19) |
| InChIKey | NNZUNJKPUBBERB-UHFFFAOYSA-N |
| XLogP | 1.13 |
| TPSA | 99.69 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 297.32 |
| LogP ≤ 5 | 1.13 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |