C17H20N6OS — CID 51113708
N-(2-benzylsulfanylethyl)-2-[methyl(7H-purin-6-yl)amino]acetamide (PubChem CID 51113708) has the molecular formula C17H20N6OS and a molecular weight of 356.45 g/mol. Its IUPAC name is N-(2-benzylsulfanylethyl)-2-[methyl(7H-purin-6-yl)amino]acetamide.
| Compound Name | N-(2-benzylsulfanylethyl)-2-[methyl(7H-purin-6-yl)amino]acetamide |
|---|---|
| PubChem CID | 51113708 |
| Molecular Formula | C17H20N6OS |
| Molecular Weight | 356.45 g/mol |
| Exact Mass | 356.14 |
| IUPAC Name | N-(2-benzylsulfanylethyl)-2-[methyl(7H-purin-6-yl)amino]acetamide |
| SMILES | CN(CC(=O)NCCSCc1ccccc1)c1ncnc2nc[nH]c12 |
| InChI | InChI=1S/C17H20N6OS/c1-23(17-15-16(20-11-19-15)21-12-22-17)9-14(24)18-7-8-25-10-13-5-3-2-4-6-13/h2-6,11-12H,7-10H2,1H3,(H,18,24)(H,19,20,21,22) |
| InChIKey | SMYFYFGGFOKGTF-UHFFFAOYSA-N |
| XLogP | 1.84 |
| TPSA | 86.80 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 356.45 |
| LogP ≤ 5 | 1.84 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|