C17H26N6O2 — CID 51077841
N-(3-cyclohexyloxypropyl)-2-[methyl(7H-purin-6-yl)amino]acetamide (PubChem CID 51077841) has the molecular formula C17H26N6O2 and a molecular weight of 346.44 g/mol. Its IUPAC name is N-(3-cyclohexyloxypropyl)-2-[methyl(7H-purin-6-yl)amino]acetamide.
| Compound Name | N-(3-cyclohexyloxypropyl)-2-[methyl(7H-purin-6-yl)amino]acetamide |
|---|---|
| PubChem CID | 51077841 |
| Molecular Formula | C17H26N6O2 |
| Molecular Weight | 346.44 g/mol |
| Exact Mass | 346.21 |
| IUPAC Name | N-(3-cyclohexyloxypropyl)-2-[methyl(7H-purin-6-yl)amino]acetamide |
| SMILES | CN(CC(=O)NCCCOC1CCCCC1)c1ncnc2nc[nH]c12 |
| InChI | InChI=1S/C17H26N6O2/c1-23(17-15-16(20-11-19-15)21-12-22-17)10-14(24)18-8-5-9-25-13-6-3-2-4-7-13/h11-13H,2-10H2,1H3,(H,18,24)(H,19,20,21,22) |
| InChIKey | CPXJRLKOWTZOMK-UHFFFAOYSA-N |
| XLogP | 1.64 |
| TPSA | 96.03 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 346.44 |
| LogP ≤ 5 | 1.64 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|