C17H27N7O — CID 119621339
N-[2-(cycloheptylamino)ethyl]-2-[methyl(7H-purin-6-yl)amino]acetamide (PubChem CID 119621339) has the molecular formula C17H27N7O and a molecular weight of 345.45 g/mol. Its IUPAC name is N-[2-(cycloheptylamino)ethyl]-2-[methyl(7H-purin-6-yl)amino]acetamide.
| Compound Name | N-[2-(cycloheptylamino)ethyl]-2-[methyl(7H-purin-6-yl)amino]acetamide |
|---|---|
| PubChem CID | 119621339 |
| Molecular Formula | C17H27N7O |
| Molecular Weight | 345.45 g/mol |
| Exact Mass | 345.23 |
| IUPAC Name | N-[2-(cycloheptylamino)ethyl]-2-[methyl(7H-purin-6-yl)amino]acetamide |
| SMILES | CN(CC(=O)NCCNC1CCCCCC1)c1ncnc2nc[nH]c12 |
| InChI | InChI=1S/C17H27N7O/c1-24(17-15-16(21-11-20-15)22-12-23-17)10-14(25)19-9-8-18-13-6-4-2-3-5-7-13/h11-13,18H,2-10H2,1H3,(H,19,25)(H,20,21,22,23) |
| InChIKey | FFHNIAFPFAMSAX-UHFFFAOYSA-N |
| XLogP | 1.22 |
| TPSA | 98.83 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 345.45 |
| LogP ≤ 5 | 1.22 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|