C16H22N6OS — CID 124777152
1-[(4aR,8aR)-2,3,4a,5,6,7,8,8a-octahydrobenzo[b][1,4]thiazin-4-yl]-2-[methyl(7H-purin-6-yl)amino]ethanone (PubChem CID 124777152) has the molecular formula C16H22N6OS and a molecular weight of 346.46 g/mol. Its IUPAC name is 1-[(4aR,8aR)-2,3,4a,5,6,7,8,8a-octahydrobenzo[b][1,4]thiazin-4-yl]-2-[methyl(7H-purin-6-yl)amino]ethanone.
| Compound Name | 1-[(4aR,8aR)-2,3,4a,5,6,7,8,8a-octahydrobenzo[b][1,4]thiazin-4-yl]-2-[methyl(7H-purin-6-yl)amino]ethanone |
|---|---|
| PubChem CID | 124777152 |
| Molecular Formula | C16H22N6OS |
| Molecular Weight | 346.46 g/mol |
| Exact Mass | 346.16 |
| IUPAC Name | 1-[(4aR,8aR)-2,3,4a,5,6,7,8,8a-octahydrobenzo[b][1,4]thiazin-4-yl]-2-[methyl(7H-purin-6-yl)amino]ethanone |
| SMILES | CN(CC(=O)N1CCS[C@@H]2CCCC[C@H]21)c1ncnc2nc[nH]c12 |
| InChI | InChI=1S/C16H22N6OS/c1-21(16-14-15(18-9-17-14)19-10-20-16)8-13(23)22-6-7-24-12-5-3-2-4-11(12)22/h9-12H,2-8H2,1H3,(H,17,18,19,20)/t11-,12-/m1/s1 |
| InChIKey | MHMCNZMZNRBKAV-VXGBXAGGSA-N |
| XLogP | 1.68 |
| TPSA | 78.01 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 346.46 |
| LogP ≤ 5 | 1.68 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |