C16H18N6OS — CID 97313680
2-[methyl(7H-purin-6-yl)amino]-1-[(2S)-2-thiophen-3-ylpyrrolidin-1-yl]ethanone (PubChem CID 97313680) has the molecular formula C16H18N6OS and a molecular weight of 342.43 g/mol. Its IUPAC name is 2-[methyl(7H-purin-6-yl)amino]-1-[(2S)-2-thiophen-3-ylpyrrolidin-1-yl]ethanone.
| Compound Name | 2-[methyl(7H-purin-6-yl)amino]-1-[(2S)-2-thiophen-3-ylpyrrolidin-1-yl]ethanone |
|---|---|
| PubChem CID | 97313680 |
| Molecular Formula | C16H18N6OS |
| Molecular Weight | 342.43 g/mol |
| Exact Mass | 342.13 |
| IUPAC Name | 2-[methyl(7H-purin-6-yl)amino]-1-[(2S)-2-thiophen-3-ylpyrrolidin-1-yl]ethanone |
| SMILES | CN(CC(=O)N1CCC[C@H]1c1ccsc1)c1ncnc2nc[nH]c12 |
| InChI | InChI=1S/C16H18N6OS/c1-21(16-14-15(18-9-17-14)19-10-20-16)7-13(23)22-5-2-3-12(22)11-4-6-24-8-11/h4,6,8-10,12H,2-3,5,7H2,1H3,(H,17,18,19,20)/t12-/m0/s1 |
| InChIKey | HIXVDANILSZYGP-LBPRGKRZSA-N |
| XLogP | 2.21 |
| TPSA | 78.01 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 342.43 |
| LogP ≤ 5 | 2.21 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |