C17H24N6O — CID 97314495
1-[(4aR,8aS)-3,4,4a,5,6,7,8,8a-octahydro-1H-isoquinolin-2-yl]-2-[methyl(7H-purin-6-yl)amino]ethanone (PubChem CID 97314495) has the molecular formula C17H24N6O and a molecular weight of 328.42 g/mol. Its IUPAC name is 1-[(4aR,8aS)-3,4,4a,5,6,7,8,8a-octahydro-1H-isoquinolin-2-yl]-2-[methyl(7H-purin-6-yl)amino]ethanone.
| Compound Name | 1-[(4aR,8aS)-3,4,4a,5,6,7,8,8a-octahydro-1H-isoquinolin-2-yl]-2-[methyl(7H-purin-6-yl)amino]ethanone |
|---|---|
| PubChem CID | 97314495 |
| Molecular Formula | C17H24N6O |
| Molecular Weight | 328.42 g/mol |
| Exact Mass | 328.20 |
| IUPAC Name | 1-[(4aR,8aS)-3,4,4a,5,6,7,8,8a-octahydro-1H-isoquinolin-2-yl]-2-[methyl(7H-purin-6-yl)amino]ethanone |
| SMILES | CN(CC(=O)N1CC[C@H]2CCCC[C@@H]2C1)c1ncnc2nc[nH]c12 |
| InChI | InChI=1S/C17H24N6O/c1-22(17-15-16(19-10-18-15)20-11-21-17)9-14(24)23-7-6-12-4-2-3-5-13(12)8-23/h10-13H,2-9H2,1H3,(H,18,19,20,21)/t12-,13-/m1/s1 |
| InChIKey | YXVBLHUZAJYDGK-CHWSQXEVSA-N |
| XLogP | 1.83 |
| TPSA | 78.01 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 328.42 |
| LogP ≤ 5 | 1.83 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |