C16H15N7O — CID 51089069
N-[(3-cyanophenyl)methyl]-2-[methyl(7H-purin-6-yl)amino]acetamide (PubChem CID 51089069) has the molecular formula C16H15N7O and a molecular weight of 321.34 g/mol. Its IUPAC name is N-[(3-cyanophenyl)methyl]-2-[methyl(7H-purin-6-yl)amino]acetamide.
| Compound Name | N-[(3-cyanophenyl)methyl]-2-[methyl(7H-purin-6-yl)amino]acetamide |
|---|---|
| PubChem CID | 51089069 |
| Molecular Formula | C16H15N7O |
| Molecular Weight | 321.34 g/mol |
| Exact Mass | 321.13 |
| IUPAC Name | N-[(3-cyanophenyl)methyl]-2-[methyl(7H-purin-6-yl)amino]acetamide |
| SMILES | CN(CC(=O)NCc1cccc(C#N)c1)c1ncnc2nc[nH]c12 |
| InChI | InChI=1S/C16H15N7O/c1-23(16-14-15(20-9-19-14)21-10-22-16)8-13(24)18-7-12-4-2-3-11(5-12)6-17/h2-5,9-10H,7-8H2,1H3,(H,18,24)(H,19,20,21,22) |
| InChIKey | CYNKEKPJZYQNRT-UHFFFAOYSA-N |
| XLogP | 0.98 |
| TPSA | 110.59 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 321.34 |
| LogP ≤ 5 | 0.98 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |