C16H17FN6O2 — CID 75479593
N-[2-(3-fluorophenoxy)ethyl]-2-[methyl(7H-purin-6-yl)amino]acetamide (PubChem CID 75479593) has the molecular formula C16H17FN6O2 and a molecular weight of 344.35 g/mol. Its IUPAC name is N-[2-(3-fluorophenoxy)ethyl]-2-[methyl(7H-purin-6-yl)amino]acetamide.
| Compound Name | N-[2-(3-fluorophenoxy)ethyl]-2-[methyl(7H-purin-6-yl)amino]acetamide |
|---|---|
| PubChem CID | 75479593 |
| Molecular Formula | C16H17FN6O2 |
| Molecular Weight | 344.35 g/mol |
| Exact Mass | 344.14 |
| IUPAC Name | N-[2-(3-fluorophenoxy)ethyl]-2-[methyl(7H-purin-6-yl)amino]acetamide |
| SMILES | CN(CC(=O)NCCOc1cccc(F)c1)c1ncnc2nc[nH]c12 |
| InChI | InChI=1S/C16H17FN6O2/c1-23(16-14-15(20-9-19-14)21-10-22-16)8-13(24)18-5-6-25-12-4-2-3-11(17)7-12/h2-4,7,9-10H,5-6,8H2,1H3,(H,18,24)(H,19,20,21,22) |
| InChIKey | FSNZVHRVEDMGEP-UHFFFAOYSA-N |
| XLogP | 1.12 |
| TPSA | 96.03 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 344.35 |
| LogP ≤ 5 | 1.12 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|