C14H16N6OS — CID 94078674
2-[methyl(7H-purin-6-yl)amino]-N-[(1S)-1-thiophen-2-ylethyl]acetamide (PubChem CID 94078674) has the molecular formula C14H16N6OS and a molecular weight of 316.39 g/mol. Its IUPAC name is 2-[methyl(7H-purin-6-yl)amino]-N-[(1S)-1-thiophen-2-ylethyl]acetamide.
| Compound Name | 2-[methyl(7H-purin-6-yl)amino]-N-[(1S)-1-thiophen-2-ylethyl]acetamide |
|---|---|
| PubChem CID | 94078674 |
| Molecular Formula | C14H16N6OS |
| Molecular Weight | 316.39 g/mol |
| Exact Mass | 316.11 |
| IUPAC Name | 2-[methyl(7H-purin-6-yl)amino]-N-[(1S)-1-thiophen-2-ylethyl]acetamide |
| SMILES | C[C@H](NC(=O)CN(C)c1ncnc2nc[nH]c12)c1cccs1 |
| InChI | InChI=1S/C14H16N6OS/c1-9(10-4-3-5-22-10)19-11(21)6-20(2)14-12-13(16-7-15-12)17-8-18-14/h3-5,7-9H,6H2,1-2H3,(H,19,21)(H,15,16,17,18)/t9-/m0/s1 |
| InChIKey | DPTUVOUAAUNERV-VIFPVBQESA-N |
| XLogP | 1.73 |
| TPSA | 86.80 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 316.39 |
| LogP ≤ 5 | 1.73 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |