C15H18N8O — CID 166409827
N-[2-(3-but-3-ynyldiazirin-3-yl)ethyl]-2-[methyl(7H-purin-6-yl)amino]acetamide (PubChem CID 166409827) has the molecular formula C15H18N8O and a molecular weight of 326.36 g/mol. Its IUPAC name is N-[2-(3-but-3-ynyldiazirin-3-yl)ethyl]-2-[methyl(7H-purin-6-yl)amino]acetamide.
| Compound Name | N-[2-(3-but-3-ynyldiazirin-3-yl)ethyl]-2-[methyl(7H-purin-6-yl)amino]acetamide |
|---|---|
| PubChem CID | 166409827 |
| Molecular Formula | C15H18N8O |
| Molecular Weight | 326.36 g/mol |
| Exact Mass | 326.16 |
| IUPAC Name | N-[2-(3-but-3-ynyldiazirin-3-yl)ethyl]-2-[methyl(7H-purin-6-yl)amino]acetamide |
| SMILES | C#CCCC1(CCNC(=O)CN(C)c2ncnc3nc[nH]c23)N=N1 |
| InChI | InChI=1S/C15H18N8O/c1-3-4-5-15(21-22-15)6-7-16-11(24)8-23(2)14-12-13(18-9-17-12)19-10-20-14/h1,9-10H,4-8H2,2H3,(H,16,24)(H,17,18,19,20) |
| InChIKey | HBIPSPVIVHOJCO-UHFFFAOYSA-N |
| XLogP | 0.87 |
| TPSA | 111.52 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 326.36 |
| LogP ≤ 5 | 0.87 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|