C14H16N6O2 — CID 75466744
N-(furan-2-ylmethyl)-N-methyl-2-[methyl(7H-purin-6-yl)amino]acetamide (PubChem CID 75466744) has the molecular formula C14H16N6O2 and a molecular weight of 300.32 g/mol. Its IUPAC name is N-(furan-2-ylmethyl)-N-methyl-2-[methyl(7H-purin-6-yl)amino]acetamide.
| Compound Name | N-(furan-2-ylmethyl)-N-methyl-2-[methyl(7H-purin-6-yl)amino]acetamide |
|---|---|
| PubChem CID | 75466744 |
| Molecular Formula | C14H16N6O2 |
| Molecular Weight | 300.32 g/mol |
| Exact Mass | 300.13 |
| IUPAC Name | N-(furan-2-ylmethyl)-N-methyl-2-[methyl(7H-purin-6-yl)amino]acetamide |
| SMILES | CN(Cc1ccco1)C(=O)CN(C)c1ncnc2nc[nH]c12 |
| InChI | InChI=1S/C14H16N6O2/c1-19(6-10-4-3-5-22-10)11(21)7-20(2)14-12-13(16-8-15-12)17-9-18-14/h3-5,8-9H,6-7H2,1-2H3,(H,15,16,17,18) |
| InChIKey | BDHKPAUSUWWYMK-UHFFFAOYSA-N |
| XLogP | 1.04 |
| TPSA | 91.15 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 300.32 |
| LogP ≤ 5 | 1.04 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |