C19H14N6O3S — CID 74228199
N-(furan-2-ylmethyl)-N-(7H-purin-6-yl)quinoline-8-sulfonamide (PubChem CID 74228199) has the molecular formula C19H14N6O3S and a molecular weight of 406.43 g/mol. Its IUPAC name is N-(furan-2-ylmethyl)-N-(7H-purin-6-yl)quinoline-8-sulfonamide.
| Compound Name | N-(furan-2-ylmethyl)-N-(7H-purin-6-yl)quinoline-8-sulfonamide |
|---|---|
| PubChem CID | 74228199 |
| Molecular Formula | C19H14N6O3S |
| Molecular Weight | 406.43 g/mol |
| Exact Mass | 406.08 |
| IUPAC Name | N-(furan-2-ylmethyl)-N-(7H-purin-6-yl)quinoline-8-sulfonamide |
| SMILES | O=S(=O)(c1cccc2cccnc12)N(Cc1ccco1)c1ncnc2nc[nH]c12 |
| InChI | InChI=1S/C19H14N6O3S/c26-29(27,15-7-1-4-13-5-2-8-20-16(13)15)25(10-14-6-3-9-28-14)19-17-18(22-11-21-17)23-12-24-19/h1-9,11-12H,10H2,(H,21,22,23,24) |
| InChIKey | BPRJYATYQFZRPX-UHFFFAOYSA-N |
| XLogP | 2.89 |
| TPSA | 117.87 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 406.43 |
| LogP ≤ 5 | 2.89 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |